C12H8Br2ClF2NO2 — CID 63420324
3-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-4-(difluoromethoxy)aniline (PubChem CID 63420324) has the molecular formula C12H8Br2ClF2NO2 and a molecular weight of 431.46 g/mol. Its IUPAC name is 3-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-4-(difluoromethoxy)aniline.
| Compound Name | 3-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-4-(difluoromethoxy)aniline |
|---|---|
| PubChem CID | 63420324 |
| Molecular Formula | C12H8Br2ClF2NO2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 428.86 |
| IUPAC Name | 3-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-4-(difluoromethoxy)aniline |
| SMILES | FC(F)Oc1ccc(NCc2cc(Br)c(Br)o2)cc1Cl |
| InChI | InChI=1S/C12H8Br2ClF2NO2/c13-8-4-7(19-11(8)14)5-18-6-1-2-10(9(15)3-6)20-12(16)17/h1-4,12,18H,5H2 |
| InChIKey | PNHWYOKRVXPXSH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|