C11H8Br2ClNO — CID 62086062
4-chloro-N-[(4,5-dibromofuran-2-yl)methyl]aniline (PubChem CID 62086062) has the molecular formula C11H8Br2ClNO and a molecular weight of 365.45 g/mol. Its IUPAC name is 4-chloro-N-[(4,5-dibromofuran-2-yl)methyl]aniline.
| Compound Name | 4-chloro-N-[(4,5-dibromofuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 62086062 |
| Molecular Formula | C11H8Br2ClNO |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 362.87 |
| IUPAC Name | 4-chloro-N-[(4,5-dibromofuran-2-yl)methyl]aniline |
| SMILES | Clc1ccc(NCc2cc(Br)c(Br)o2)cc1 |
| InChI | InChI=1S/C11H8Br2ClNO/c12-10-5-9(16-11(10)13)6-15-8-3-1-7(14)2-4-8/h1-5,15H,6H2 |
| InChIKey | PZEOQZNFJCSUIB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |