C12H11Br2NO — CID 62084803
N-[(4,5-dibromofuran-2-yl)methyl]-4-methylaniline (PubChem CID 62084803) has the molecular formula C12H11Br2NO and a molecular weight of 345.03 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-4-methylaniline.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-4-methylaniline |
|---|---|
| PubChem CID | 62084803 |
| Molecular Formula | C12H11Br2NO |
| Molecular Weight | 345.03 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-4-methylaniline |
| SMILES | Cc1ccc(NCc2cc(Br)c(Br)o2)cc1 |
| InChI | InChI=1S/C12H11Br2NO/c1-8-2-4-9(5-3-8)15-7-10-6-11(13)12(14)16-10/h2-6,15H,7H2,1H3 |
| InChIKey | NBGHUUKFJAYAJI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.03 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |