C12H10Br2N2O3 — CID 112557580
N-[(4,5-dibromofuran-2-yl)methyl]-5-methyl-2-nitroaniline (PubChem CID 112557580) has the molecular formula C12H10Br2N2O3 and a molecular weight of 390.03 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-5-methyl-2-nitroaniline.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-5-methyl-2-nitroaniline |
|---|---|
| PubChem CID | 112557580 |
| Molecular Formula | C12H10Br2N2O3 |
| Molecular Weight | 390.03 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-5-methyl-2-nitroaniline |
| SMILES | Cc1ccc([N+](=O)[O-])c(NCc2cc(Br)c(Br)o2)c1 |
| InChI | InChI=1S/C12H10Br2N2O3/c1-7-2-3-11(16(17)18)10(4-7)15-6-8-5-9(13)12(14)19-8/h2-5,15H,6H2,1H3 |
| InChIKey | UDVFBCBRKNAXIZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.03 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|