C13H12Br2N2O3 — CID 63477611
N-[(4,5-dibromofuran-2-yl)methyl]-4,5-dimethyl-2-nitroaniline (PubChem CID 63477611) has the molecular formula C13H12Br2N2O3 and a molecular weight of 404.06 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-4,5-dimethyl-2-nitroaniline.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-4,5-dimethyl-2-nitroaniline |
|---|---|
| PubChem CID | 63477611 |
| Molecular Formula | C13H12Br2N2O3 |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 401.92 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-4,5-dimethyl-2-nitroaniline |
| SMILES | Cc1cc(NCc2cc(Br)c(Br)o2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C13H12Br2N2O3/c1-7-3-11(12(17(18)19)4-8(7)2)16-6-9-5-10(14)13(15)20-9/h3-5,16H,6H2,1-2H3 |
| InChIKey | RNCYENSYEHEYPT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 68.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|