C13H15N3O2S — CID 66385600
2-[(4,5-dimethyl-2-nitroanilino)methyl]thiophen-3-amine (PubChem CID 66385600) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-2-nitroanilino)methyl]thiophen-3-amine.
| Compound Name | 2-[(4,5-dimethyl-2-nitroanilino)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66385600 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[(4,5-dimethyl-2-nitroanilino)methyl]thiophen-3-amine |
| SMILES | Cc1cc(NCc2sccc2N)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C13H15N3O2S/c1-8-5-11(12(16(17)18)6-9(8)2)15-7-13-10(14)3-4-19-13/h3-6,15H,7,14H2,1-2H3 |
| InChIKey | ZUATWIALBRXDRE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|