C12H12Cl2N2S — CID 113445815
2-[(2,5-dichloro-4-methylanilino)methyl]thiophen-3-amine (PubChem CID 113445815) has the molecular formula C12H12Cl2N2S and a molecular weight of 287.21 g/mol. Its IUPAC name is 2-[(2,5-dichloro-4-methylanilino)methyl]thiophen-3-amine.
| Compound Name | 2-[(2,5-dichloro-4-methylanilino)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 113445815 |
| Molecular Formula | C12H12Cl2N2S |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-[(2,5-dichloro-4-methylanilino)methyl]thiophen-3-amine |
| SMILES | Cc1cc(Cl)c(NCc2sccc2N)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2S/c1-7-4-9(14)11(5-8(7)13)16-6-12-10(15)2-3-17-12/h2-5,16H,6,15H2,1H3 |
| InChIKey | GEDZQJRWTXETOW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |