C11H9Cl2FN2S — CID 107572996
2-[(3,5-dichloro-4-fluoroanilino)methyl]thiophen-3-amine (PubChem CID 107572996) has the molecular formula C11H9Cl2FN2S and a molecular weight of 291.18 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-fluoroanilino)methyl]thiophen-3-amine.
| Compound Name | 2-[(3,5-dichloro-4-fluoroanilino)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 107572996 |
| Molecular Formula | C11H9Cl2FN2S |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 2-[(3,5-dichloro-4-fluoroanilino)methyl]thiophen-3-amine |
| SMILES | Nc1ccsc1CNc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2FN2S/c12-7-3-6(4-8(13)11(7)14)16-5-10-9(15)1-2-17-10/h1-4,16H,5,15H2 |
| InChIKey | VGCCWNHCXVHCEH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|