C13H14ClN3OS — CID 66387552
3-[(3-aminothiophen-2-yl)methylamino]-4-chloro-N-methylbenzamide (PubChem CID 66387552) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 3-[(3-aminothiophen-2-yl)methylamino]-4-chloro-N-methylbenzamide.
| Compound Name | 3-[(3-aminothiophen-2-yl)methylamino]-4-chloro-N-methylbenzamide |
|---|---|
| PubChem CID | 66387552 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-[(3-aminothiophen-2-yl)methylamino]-4-chloro-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(Cl)c(NCc2sccc2N)c1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-16-13(18)8-2-3-9(14)11(6-8)17-7-12-10(15)4-5-19-12/h2-6,17H,7,15H2,1H3,(H,16,18) |
| InChIKey | YMSSMFFIDOAMRG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |