C15H15ClN2O3 — CID 43720990
4-chloro-3-[(2,4-dihydroxyphenyl)methylamino]-N-methylbenzamide (PubChem CID 43720990) has the molecular formula C15H15ClN2O3 and a molecular weight of 306.75 g/mol. Its IUPAC name is 4-chloro-3-[(2,4-dihydroxyphenyl)methylamino]-N-methylbenzamide.
| Compound Name | 4-chloro-3-[(2,4-dihydroxyphenyl)methylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 43720990 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-chloro-3-[(2,4-dihydroxyphenyl)methylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(Cl)c(NCc2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C15H15ClN2O3/c1-17-15(21)9-3-5-12(16)13(6-9)18-8-10-2-4-11(19)7-14(10)20/h2-7,18-20H,8H2,1H3,(H,17,21) |
| InChIKey | LBSYPAPFFMBVBZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|