C12H7Br2N3O3 — CID 78965483
4-[(4,5-dibromofuran-2-yl)methylamino]-3-nitrobenzonitrile (PubChem CID 78965483) has the molecular formula C12H7Br2N3O3 and a molecular weight of 401.01 g/mol. Its IUPAC name is 4-[(4,5-dibromofuran-2-yl)methylamino]-3-nitrobenzonitrile.
| Compound Name | 4-[(4,5-dibromofuran-2-yl)methylamino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 78965483 |
| Molecular Formula | C12H7Br2N3O3 |
| Molecular Weight | 401.01 g/mol |
| Exact Mass | 398.89 |
| IUPAC Name | 4-[(4,5-dibromofuran-2-yl)methylamino]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(NCc2cc(Br)c(Br)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H7Br2N3O3/c13-9-4-8(20-12(9)14)6-16-10-2-1-7(5-15)3-11(10)17(18)19/h1-4,16H,6H2 |
| InChIKey | YTJMRNRCHHPPFY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.01 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|