C14H11N3O4 — CID 78965064
4-[(2,4-dihydroxyphenyl)methylamino]-3-nitrobenzonitrile (PubChem CID 78965064) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 4-[(2,4-dihydroxyphenyl)methylamino]-3-nitrobenzonitrile.
| Compound Name | 4-[(2,4-dihydroxyphenyl)methylamino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 78965064 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-[(2,4-dihydroxyphenyl)methylamino]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(NCc2ccc(O)cc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11N3O4/c15-7-9-1-4-12(13(5-9)17(20)21)16-8-10-2-3-11(18)6-14(10)19/h1-6,16,18-19H,8H2 |
| InChIKey | CFZWMVIESCRTRU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|