C14H11BrN2O2 — CID 43722774
3-bromo-4-[(2,4-dihydroxyphenyl)methylamino]benzonitrile (PubChem CID 43722774) has the molecular formula C14H11BrN2O2 and a molecular weight of 319.16 g/mol. Its IUPAC name is 3-bromo-4-[(2,4-dihydroxyphenyl)methylamino]benzonitrile.
| Compound Name | 3-bromo-4-[(2,4-dihydroxyphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 43722774 |
| Molecular Formula | C14H11BrN2O2 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 3-bromo-4-[(2,4-dihydroxyphenyl)methylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCc2ccc(O)cc2O)c(Br)c1 |
| InChI | InChI=1S/C14H11BrN2O2/c15-12-5-9(7-16)1-4-13(12)17-8-10-2-3-11(18)6-14(10)19/h1-6,17-19H,8H2 |
| InChIKey | IRHJRRJPQGECLL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|