C16H15N3O4 — CID 31664197
4-[(2,5-dimethoxyphenyl)methylamino]-3-nitrobenzonitrile (PubChem CID 31664197) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methylamino]-3-nitrobenzonitrile.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methylamino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 31664197 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methylamino]-3-nitrobenzonitrile |
| SMILES | COc1ccc(OC)c(CNc2ccc(C#N)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N3O4/c1-22-13-4-6-16(23-2)12(8-13)10-18-14-5-3-11(9-17)7-15(14)19(20)21/h3-8,18H,10H2,1-2H3 |
| InChIKey | BPTYHVGHRCXKFZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|