C16H15F3N2O4 — CID 31663943
N-[(2,5-dimethoxyphenyl)methyl]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 31663943) has the molecular formula C16H15F3N2O4 and a molecular weight of 356.30 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 31663943 |
| Molecular Formula | C16H15F3N2O4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | COc1ccc(OC)c(CNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15F3N2O4/c1-24-12-4-6-15(25-2)10(7-12)9-20-13-5-3-11(16(17,18)19)8-14(13)21(22)23/h3-8,20H,9H2,1-2H3 |
| InChIKey | SPWCQJNHASHIGD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|