C13H12Br2N2O3 — CID 62083592
2-[4-[(4,5-dibromofuran-2-yl)methylamino]phenoxy]acetamide (PubChem CID 62083592) has the molecular formula C13H12Br2N2O3 and a molecular weight of 404.06 g/mol. Its IUPAC name is 2-[4-[(4,5-dibromofuran-2-yl)methylamino]phenoxy]acetamide.
| Compound Name | 2-[4-[(4,5-dibromofuran-2-yl)methylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 62083592 |
| Molecular Formula | C13H12Br2N2O3 |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 401.92 |
| IUPAC Name | 2-[4-[(4,5-dibromofuran-2-yl)methylamino]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(NCc2cc(Br)c(Br)o2)cc1 |
| InChI | InChI=1S/C13H12Br2N2O3/c14-11-5-10(20-13(11)15)6-17-8-1-3-9(4-2-8)19-7-12(16)18/h1-5,17H,6-7H2,(H2,16,18) |
| InChIKey | ZQGXTKPFAOOTFW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|