C15H14Br2N2O2 — CID 115743088
2-[4-[(3,4-dibromophenyl)methylamino]phenoxy]acetamide (PubChem CID 115743088) has the molecular formula C15H14Br2N2O2 and a molecular weight of 414.10 g/mol. Its IUPAC name is 2-[4-[(3,4-dibromophenyl)methylamino]phenoxy]acetamide.
| Compound Name | 2-[4-[(3,4-dibromophenyl)methylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 115743088 |
| Molecular Formula | C15H14Br2N2O2 |
| Molecular Weight | 414.10 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | 2-[4-[(3,4-dibromophenyl)methylamino]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(NCc2ccc(Br)c(Br)c2)cc1 |
| InChI | InChI=1S/C15H14Br2N2O2/c16-13-6-1-10(7-14(13)17)8-19-11-2-4-12(5-3-11)21-9-15(18)20/h1-7,19H,8-9H2,(H2,18,20) |
| InChIKey | KXLBMOKZNSEUGQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.10 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|