C14H12Br2N2O — CID 115753010
4-[(3,4-dibromophenyl)methylamino]benzamide (PubChem CID 115753010) has the molecular formula C14H12Br2N2O and a molecular weight of 384.07 g/mol. Its IUPAC name is 4-[(3,4-dibromophenyl)methylamino]benzamide.
| Compound Name | 4-[(3,4-dibromophenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 115753010 |
| Molecular Formula | C14H12Br2N2O |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 381.93 |
| IUPAC Name | 4-[(3,4-dibromophenyl)methylamino]benzamide |
| SMILES | NC(=O)c1ccc(NCc2ccc(Br)c(Br)c2)cc1 |
| InChI | InChI=1S/C14H12Br2N2O/c15-12-6-1-9(7-13(12)16)8-18-11-4-2-10(3-5-11)14(17)19/h1-7,18H,8H2,(H2,17,19) |
| InChIKey | DHEQLNFRDDGTQX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |