C12H8Br2N2OS — CID 107804067
N-[(4,5-dibromofuran-2-yl)methyl]-1,3-benzothiazol-6-amine (PubChem CID 107804067) has the molecular formula C12H8Br2N2OS and a molecular weight of 388.08 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-1,3-benzothiazol-6-amine.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 107804067 |
| Molecular Formula | C12H8Br2N2OS |
| Molecular Weight | 388.08 g/mol |
| Exact Mass | 385.87 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-1,3-benzothiazol-6-amine |
| SMILES | Brc1cc(CNc2ccc3ncsc3c2)oc1Br |
| InChI | InChI=1S/C12H8Br2N2OS/c13-9-4-8(17-12(9)14)5-15-7-1-2-10-11(3-7)18-6-16-10/h1-4,6,15H,5H2 |
| InChIKey | LXPVZULZPJUWPM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.08 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |