C13H12Br2ClNO2 — CID 63450941
5-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-2-ethoxyaniline (PubChem CID 63450941) has the molecular formula C13H12Br2ClNO2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-2-ethoxyaniline.
| Compound Name | 5-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-2-ethoxyaniline |
|---|---|
| PubChem CID | 63450941 |
| Molecular Formula | C13H12Br2ClNO2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 406.89 |
| IUPAC Name | 5-chloro-N-[(4,5-dibromofuran-2-yl)methyl]-2-ethoxyaniline |
| SMILES | CCOc1ccc(Cl)cc1NCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C13H12Br2ClNO2/c1-2-18-12-4-3-8(16)5-11(12)17-7-9-6-10(14)13(15)19-9/h3-6,17H,2,7H2,1H3 |
| InChIKey | NPWMIZNKJUFRSV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |