C14H15ClINO2 — CID 63453193
5-chloro-N-[(5-iodofuran-2-yl)methyl]-2-propoxyaniline (PubChem CID 63453193) has the molecular formula C14H15ClINO2 and a molecular weight of 391.64 g/mol. Its IUPAC name is 5-chloro-N-[(5-iodofuran-2-yl)methyl]-2-propoxyaniline.
| Compound Name | 5-chloro-N-[(5-iodofuran-2-yl)methyl]-2-propoxyaniline |
|---|---|
| PubChem CID | 63453193 |
| Molecular Formula | C14H15ClINO2 |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 5-chloro-N-[(5-iodofuran-2-yl)methyl]-2-propoxyaniline |
| SMILES | CCCOc1ccc(Cl)cc1NCc1ccc(I)o1 |
| InChI | InChI=1S/C14H15ClINO2/c1-2-7-18-13-5-3-10(15)8-12(13)17-9-11-4-6-14(16)19-11/h3-6,8,17H,2,7,9H2,1H3 |
| InChIKey | VGBARVMMJQOOAU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|