C13H16BrF3N2O — CID 107335909
3-bromo-N-(piperidin-3-ylmethyl)-4-(trifluoromethoxy)aniline (PubChem CID 107335909) has the molecular formula C13H16BrF3N2O and a molecular weight of 353.18 g/mol. Its IUPAC name is 3-bromo-N-(piperidin-3-ylmethyl)-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-(piperidin-3-ylmethyl)-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107335909 |
| Molecular Formula | C13H16BrF3N2O |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3-bromo-N-(piperidin-3-ylmethyl)-4-(trifluoromethoxy)aniline |
| SMILES | FC(F)(F)Oc1ccc(NCC2CCCNC2)cc1Br |
| InChI | InChI=1S/C13H16BrF3N2O/c14-11-6-10(3-4-12(11)20-13(15,16)17)19-8-9-2-1-5-18-7-9/h3-4,6,9,18-19H,1-2,5,7-8H2 |
| InChIKey | DBAYJAPMYJYRTE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|