C13H14BrF3N2O2 — CID 107336161
4-[3-bromo-4-(trifluoromethoxy)anilino]azepan-2-one (PubChem CID 107336161) has the molecular formula C13H14BrF3N2O2 and a molecular weight of 367.17 g/mol. Its IUPAC name is 4-[3-bromo-4-(trifluoromethoxy)anilino]azepan-2-one.
| Compound Name | 4-[3-bromo-4-(trifluoromethoxy)anilino]azepan-2-one |
|---|---|
| PubChem CID | 107336161 |
| Molecular Formula | C13H14BrF3N2O2 |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 4-[3-bromo-4-(trifluoromethoxy)anilino]azepan-2-one |
| SMILES | O=C1CC(Nc2ccc(OC(F)(F)F)c(Br)c2)CCCN1 |
| InChI | InChI=1S/C13H14BrF3N2O2/c14-10-6-9(3-4-11(10)21-13(15,16)17)19-8-2-1-5-18-12(20)7-8/h3-4,6,8,19H,1-2,5,7H2,(H,18,20) |
| InChIKey | IMUFECXSXIMPKZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|