C14H17BrF3NO2 — CID 107335818
3-bromo-N-(3-methoxycyclohexyl)-4-(trifluoromethoxy)aniline (PubChem CID 107335818) has the molecular formula C14H17BrF3NO2 and a molecular weight of 368.19 g/mol. Its IUPAC name is 3-bromo-N-(3-methoxycyclohexyl)-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-(3-methoxycyclohexyl)-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107335818 |
| Molecular Formula | C14H17BrF3NO2 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3-bromo-N-(3-methoxycyclohexyl)-4-(trifluoromethoxy)aniline |
| SMILES | COC1CCCC(Nc2ccc(OC(F)(F)F)c(Br)c2)C1 |
| InChI | InChI=1S/C14H17BrF3NO2/c1-20-11-4-2-3-9(7-11)19-10-5-6-13(12(15)8-10)21-14(16,17)18/h5-6,8-9,11,19H,2-4,7H2,1H3 |
| InChIKey | VNRAIHBXWJHPQZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|