C14H17BrF3NO — CID 107335998
3-bromo-N-(2,2-dimethylcyclopentyl)-4-(trifluoromethoxy)aniline (PubChem CID 107335998) has the molecular formula C14H17BrF3NO and a molecular weight of 352.19 g/mol. Its IUPAC name is 3-bromo-N-(2,2-dimethylcyclopentyl)-4-(trifluoromethoxy)aniline.
| Compound Name | 3-bromo-N-(2,2-dimethylcyclopentyl)-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 107335998 |
| Molecular Formula | C14H17BrF3NO |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 3-bromo-N-(2,2-dimethylcyclopentyl)-4-(trifluoromethoxy)aniline |
| SMILES | CC1(C)CCCC1Nc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C14H17BrF3NO/c1-13(2)7-3-4-12(13)19-9-5-6-11(10(15)8-9)20-14(16,17)18/h5-6,8,12,19H,3-4,7H2,1-2H3 |
| InChIKey | FEVNGSCMEUSSDX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|