C15H22ClNO — CID 79860269
3-chloro-N-(2,2-dimethylcyclopentyl)-4-ethoxyaniline (PubChem CID 79860269) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is 3-chloro-N-(2,2-dimethylcyclopentyl)-4-ethoxyaniline.
| Compound Name | 3-chloro-N-(2,2-dimethylcyclopentyl)-4-ethoxyaniline |
|---|---|
| PubChem CID | 79860269 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-chloro-N-(2,2-dimethylcyclopentyl)-4-ethoxyaniline |
| SMILES | CCOc1ccc(NC2CCCC2(C)C)cc1Cl |
| InChI | InChI=1S/C15H22ClNO/c1-4-18-13-8-7-11(10-12(13)16)17-14-6-5-9-15(14,2)3/h7-8,10,14,17H,4-6,9H2,1-3H3 |
| InChIKey | FPPZBDTXKSNOOW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|