2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid

C14H20N2O2 — CID 79872672

IUPAC2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid
SMILESCC1(C)CCCC1Nc1ccc(N)c(C(=O)O)c1
InChIInChI=1S/C14H20N2O2/c1-14(2)7-3-4-12(14)16-9-5-6-11(15)10(8-9)13(17)18/h5-6,8,12,16H,3-4,7,15H2,1-2H3,(H,17,18)
InChIKeyGMMUCTPSQLUXQB-UHFFFAOYSA-N
MW248.33 g/mol
LogP2.96
Rot. Bonds3

About 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid

2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid (PubChem CID 79872672) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid.

Molecular Properties

Compound Name2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid
PubChem CID79872672
Molecular FormulaC14H20N2O2
Molecular Weight248.33 g/mol
Exact Mass248.15
IUPAC Name2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid
SMILESCC1(C)CCCC1Nc1ccc(N)c(C(=O)O)c1
InChIInChI=1S/C14H20N2O2/c1-14(2)7-3-4-12(14)16-9-5-6-11(15)10(8-9)13(17)18/h5-6,8,12,16H,3-4,7,15H2,1-2H3,(H,17,18)
InChIKeyGMMUCTPSQLUXQB-UHFFFAOYSA-N
XLogP2.96
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.33
LogP ≤ 52.96
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid?
The IUPAC name of 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid (CID 79872672) is 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid.
What is the SMILES notation for 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid?
The canonical SMILES for 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid is CC1(C)CCCC1Nc1ccc(N)c(C(=O)O)c1.
What is the InChIKey of 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid?
The InChIKey is GMMUCTPSQLUXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-14(2)7-3-4-12(14)16-9-5-6-11(15)10(8-9)13(17)18/h5-6,8,12,16H,3-4,7,15H2,1-2H3,(H,17,18).
What are the key properties of 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid?
2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid has a molecular weight of 248.33 g/mol, XLogP of 2.96, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[(2,2-dimethylcyclopentyl)amino]benzoic acid is sourced from PubChem (CID 79872672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).