C14H21NO — CID 79859836
[3-[(2,2-dimethylcyclopentyl)amino]phenyl]methanol (PubChem CID 79859836) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is [3-[(2,2-dimethylcyclopentyl)amino]phenyl]methanol.
| Compound Name | [3-[(2,2-dimethylcyclopentyl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 79859836 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | [3-[(2,2-dimethylcyclopentyl)amino]phenyl]methanol |
| SMILES | CC1(C)CCCC1Nc1cccc(CO)c1 |
| InChI | InChI=1S/C14H21NO/c1-14(2)8-4-7-13(14)15-12-6-3-5-11(9-12)10-16/h3,5-6,9,13,15-16H,4,7-8,10H2,1-2H3 |
| InChIKey | TWLJZNILQSGOHV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |