C12H16FN — CID 130532973
N-(2,2-dimethylcyclobutyl)-3-fluoroaniline (PubChem CID 130532973) has the molecular formula C12H16FN and a molecular weight of 193.27 g/mol. Its IUPAC name is N-(2,2-dimethylcyclobutyl)-3-fluoroaniline.
| Compound Name | N-(2,2-dimethylcyclobutyl)-3-fluoroaniline |
|---|---|
| PubChem CID | 130532973 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | N-(2,2-dimethylcyclobutyl)-3-fluoroaniline |
| SMILES | CC1(C)CCC1Nc1cccc(F)c1 |
| InChI | InChI=1S/C12H16FN/c1-12(2)7-6-11(12)14-10-5-3-4-9(13)8-10/h3-5,8,11,14H,6-7H2,1-2H3 |
| InChIKey | WIEOVGALTGBWJG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |