C14H20FN — CID 79828345
N-(2,2-dimethylcyclohexyl)-4-fluoroaniline (PubChem CID 79828345) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)-4-fluoroaniline.
| Compound Name | N-(2,2-dimethylcyclohexyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 79828345 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)-4-fluoroaniline |
| SMILES | CC1(C)CCCCC1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FN/c1-14(2)10-4-3-5-13(14)16-12-8-6-11(15)7-9-12/h6-9,13,16H,3-5,10H2,1-2H3 |
| InChIKey | VCDJOJJEUFQKIL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |