C15H21F2NO — CID 79828523
4-(difluoromethoxy)-N-(2,2-dimethylcyclohexyl)aniline (PubChem CID 79828523) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(2,2-dimethylcyclohexyl)aniline.
| Compound Name | 4-(difluoromethoxy)-N-(2,2-dimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 79828523 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-(difluoromethoxy)-N-(2,2-dimethylcyclohexyl)aniline |
| SMILES | CC1(C)CCCCC1Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H21F2NO/c1-15(2)10-4-3-5-13(15)18-11-6-8-12(9-7-11)19-14(16)17/h6-9,13-14,18H,3-5,10H2,1-2H3 |
| InChIKey | NRGKABIQCKCMLL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|