C14H22N2O2S — CID 79860490
N-[4-[(2,2-dimethylcyclopentyl)amino]phenyl]methanesulfonamide (PubChem CID 79860490) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-[4-[(2,2-dimethylcyclopentyl)amino]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(2,2-dimethylcyclopentyl)amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 79860490 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-[4-[(2,2-dimethylcyclopentyl)amino]phenyl]methanesulfonamide |
| SMILES | CC1(C)CCCC1Nc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22N2O2S/c1-14(2)10-4-5-13(14)15-11-6-8-12(9-7-11)16-19(3,17)18/h6-9,13,15-16H,4-5,10H2,1-3H3 |
| InChIKey | WSDVTAPNEJMTMO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |