C16H24N2O2S — CID 79870274
N-cyclopropyl-4-[(2,2-dimethylcyclopentyl)amino]benzenesulfonamide (PubChem CID 79870274) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-cyclopropyl-4-[(2,2-dimethylcyclopentyl)amino]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[(2,2-dimethylcyclopentyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 79870274 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-cyclopropyl-4-[(2,2-dimethylcyclopentyl)amino]benzenesulfonamide |
| SMILES | CC1(C)CCCC1Nc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C16H24N2O2S/c1-16(2)11-3-4-15(16)17-12-7-9-14(10-8-12)21(19,20)18-13-5-6-13/h7-10,13,15,17-18H,3-6,11H2,1-2H3 |
| InChIKey | KVGZMJQZHKHUFD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |