C16H23NO2S — CID 59891712
N-(2,2-dimethylcyclohexyl)-4-ethenylbenzenesulfonamide (PubChem CID 59891712) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)-4-ethenylbenzenesulfonamide.
| Compound Name | N-(2,2-dimethylcyclohexyl)-4-ethenylbenzenesulfonamide |
|---|---|
| PubChem CID | 59891712 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)-4-ethenylbenzenesulfonamide |
| SMILES | C=Cc1ccc(S(=O)(=O)NC2CCCCC2(C)C)cc1 |
| InChI | InChI=1S/C16H23NO2S/c1-4-13-8-10-14(11-9-13)20(18,19)17-15-7-5-6-12-16(15,2)3/h4,8-11,15,17H,1,5-7,12H2,2-3H3 |
| InChIKey | HKNBZMDORWJDRG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |