C14H21N3O2S2 — CID 114614590
5-[(2,2-dimethylcyclohexyl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614590) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 5-[(2,2-dimethylcyclohexyl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[(2,2-dimethylcyclohexyl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614590 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 5-[(2,2-dimethylcyclohexyl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | CC1(C)CCCCC1NS(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C14H21N3O2S2/c1-14(2)8-4-3-5-12(14)17-21(18,19)10-6-7-11(13(15)20)16-9-10/h6-7,9,12,17H,3-5,8H2,1-2H3,(H2,15,20) |
| InChIKey | PNZAEBXYBRMJRC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|