C13H20N4O2S2 — CID 114614758
5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 114614758) has the molecular formula C13H20N4O2S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 114614758 |
| Molecular Formula | C13H20N4O2S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 5-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | CC1CN(C)CCC1NS(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C13H20N4O2S2/c1-9-8-17(2)6-5-11(9)16-21(18,19)10-3-4-12(13(14)20)15-7-10/h3-4,7,9,11,16H,5-6,8H2,1-2H3,(H2,14,20) |
| InChIKey | BZIQKQKNJUXCTI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|