(2,2-dimethylcyclohexyl)sulfamic acid

C8H17NO3S — CID 175440747

IUPAC(2,2-dimethylcyclohexyl)sulfamic acid
SMILESCC1(C)CCCCC1NS(=O)(=O)O
InChIInChI=1S/C8H17NO3S/c1-8(2)6-4-3-5-7(8)9-13(10,11)12/h7,9H,3-6H2,1-2H3,(H,10,11,12)
InChIKeyJKXSFDCBNSYFCQ-UHFFFAOYSA-N
MW207.29 g/mol
LogP1.35
Rot. Bonds2

About (2,2-dimethylcyclohexyl)sulfamic acid

(2,2-dimethylcyclohexyl)sulfamic acid (PubChem CID 175440747) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is (2,2-dimethylcyclohexyl)sulfamic acid.

Molecular Properties

Compound Name(2,2-dimethylcyclohexyl)sulfamic acid
PubChem CID175440747
Molecular FormulaC8H17NO3S
Molecular Weight207.29 g/mol
Exact Mass207.09
IUPAC Name(2,2-dimethylcyclohexyl)sulfamic acid
SMILESCC1(C)CCCCC1NS(=O)(=O)O
InChIInChI=1S/C8H17NO3S/c1-8(2)6-4-3-5-7(8)9-13(10,11)12/h7,9H,3-6H2,1-2H3,(H,10,11,12)
InChIKeyJKXSFDCBNSYFCQ-UHFFFAOYSA-N
XLogP1.35
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.29
LogP ≤ 51.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (2,2-dimethylcyclohexyl)sulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

N-(2-methylcyclohexyl)sulfamic acid
CID 13115365
(2-Methylcyclohexyl)sulfamic acid, cis-
CID 13115367
(2-Ethylcyclohexyl)sulfamic acid
CID 13115369
(2-Propan-2-ylcyclohexyl)sulfamic acid
CID 13115373
(2-Methylcyclohexyl)sulfamic acid, trans-
CID 54364445
(1-Methylcyclohexyl)methylsulfamic acid
CID 23197363
1-Cyclohexylethylsulfamic acid
CID 23466966
[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]sulfamic acid
CID 67462943
(5-Methyl-2-propan-2-ylcyclohexyl)sulfamic acid
CID 67464984
(2,6-Dimethylcyclohexyl)sulfamic acid
CID 67465576
1-Cyclohexylethylsulfamic acid;hydrobromide
CID 68139957
1,1,3-Trimethyl-5-(sulfinatoamino)cyclohexane
CID 68407521

Frequently Asked Questions

What is the IUPAC name of (2,2-dimethylcyclohexyl)sulfamic acid?
The IUPAC name of (2,2-dimethylcyclohexyl)sulfamic acid (CID 175440747) is (2,2-dimethylcyclohexyl)sulfamic acid.
What is the SMILES notation for (2,2-dimethylcyclohexyl)sulfamic acid?
The canonical SMILES for (2,2-dimethylcyclohexyl)sulfamic acid is CC1(C)CCCCC1NS(=O)(=O)O.
What is the InChIKey of (2,2-dimethylcyclohexyl)sulfamic acid?
The InChIKey is JKXSFDCBNSYFCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3S/c1-8(2)6-4-3-5-7(8)9-13(10,11)12/h7,9H,3-6H2,1-2H3,(H,10,11,12).
What are the key properties of (2,2-dimethylcyclohexyl)sulfamic acid?
(2,2-dimethylcyclohexyl)sulfamic acid has a molecular weight of 207.29 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethylcyclohexyl)sulfamic acid is sourced from PubChem (CID 175440747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).