About [(1R,2R)-2-methylcyclohexyl]sulfamic acid
[(1R,2R)-2-methylcyclohexyl]sulfamic acid (PubChem CID 54364445) has the molecular formula C7H15NO3S
and a molecular weight of 193.27 g/mol. Its IUPAC name is [(1R,2R)-2-methylcyclohexyl]sulfamic acid.
Molecular Properties
| Compound Name | [(1R,2R)-2-methylcyclohexyl]sulfamic acid |
| PubChem CID | 54364445 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | [(1R,2R)-2-methylcyclohexyl]sulfamic acid |
| SMILES | C[C@@H]1CCCC[C@H]1NS(=O)(=O)O |
| InChI | InChI=1S/C7H15NO3S/c1-6-4-2-3-5-7(6)8-12(9,10)11/h6-8H,2-5H2,1H3,(H,9,10,11)/t6-,7-/m1/s1 |
| InChIKey | UOUBHXLOFQQIPZ-RNFRBKRXSA-N |
| XLogP | 0.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-methylcyclohexyl]sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-methylcyclohexyl]sulfamic acid?
The IUPAC name of [(1R,2R)-2-methylcyclohexyl]sulfamic acid (CID 54364445) is [(1R,2R)-2-methylcyclohexyl]sulfamic acid.
What is the SMILES notation for [(1R,2R)-2-methylcyclohexyl]sulfamic acid?
The canonical SMILES for [(1R,2R)-2-methylcyclohexyl]sulfamic acid is C[C@@H]1CCCC[C@H]1NS(=O)(=O)O.
What is the InChIKey of [(1R,2R)-2-methylcyclohexyl]sulfamic acid?
The InChIKey is UOUBHXLOFQQIPZ-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H15NO3S/c1-6-4-2-3-5-7(6)8-12(9,10)11/h6-8H,2-5H2,1H3,(H,9,10,11)/t6-,7-/m1/s1.
What are the key properties of [(1R,2R)-2-methylcyclohexyl]sulfamic acid?
[(1R,2R)-2-methylcyclohexyl]sulfamic acid has a molecular weight of 193.27 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-methylcyclohexyl]sulfamic acid is sourced from PubChem (CID 54364445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).