C13H22N2O2S2 — CID 106071365
5-(aminomethyl)-N-(2,2-dimethylcyclohexyl)thiophene-3-sulfonamide (PubChem CID 106071365) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,2-dimethylcyclohexyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2,2-dimethylcyclohexyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106071365 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 5-(aminomethyl)-N-(2,2-dimethylcyclohexyl)thiophene-3-sulfonamide |
| SMILES | CC1(C)CCCCC1NS(=O)(=O)c1csc(CN)c1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-13(2)6-4-3-5-12(13)15-19(16,17)11-7-10(8-14)18-9-11/h7,9,12,15H,3-6,8,14H2,1-2H3 |
| InChIKey | VQCLFTLWNHSVJP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |