C14H19NO3S — CID 11845877
4-methyl-N-[(3R,4R)-1-oxaspiro[2.5]octan-4-yl]benzenesulfonamide (PubChem CID 11845877) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-methyl-N-[(3R,4R)-1-oxaspiro[2.5]octan-4-yl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(3R,4R)-1-oxaspiro[2.5]octan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11845877 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-methyl-N-[(3R,4R)-1-oxaspiro[2.5]octan-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@]23CO3)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-11-5-7-12(8-6-11)19(16,17)15-13-4-2-3-9-14(13)10-18-14/h5-8,13,15H,2-4,9-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | AZIVMZRWHYWUPV-KGLIPLIRSA-N |
| XLogP | 1.98 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|