C18H27NO3S — CID 134984235
N-[(1S,2S)-2-ethyl-2-propanoylcyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 134984235) has the molecular formula C18H27NO3S and a molecular weight of 337.48 g/mol. Its IUPAC name is N-[(1S,2S)-2-ethyl-2-propanoylcyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-ethyl-2-propanoylcyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134984235 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.48 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[(1S,2S)-2-ethyl-2-propanoylcyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | CCC(=O)[C@@]1(CC)CCCC[C@@H]1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H27NO3S/c1-4-17(20)18(5-2)13-7-6-8-16(18)19-23(21,22)15-11-9-14(3)10-12-15/h9-12,16,19H,4-8,13H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | RTDDTQYVFNAMTC-WMZOPIPTSA-N |
| XLogP | 3.59 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |