C17H24N2O5S — CID 134115577
1-(1,5-dioxaspiro[5.5]undecan-11-yl)-3-(4-methylphenyl)sulfonylurea (PubChem CID 134115577) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-(1,5-dioxaspiro[5.5]undecan-11-yl)-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-(1,5-dioxaspiro[5.5]undecan-11-yl)-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 134115577 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-(1,5-dioxaspiro[5.5]undecan-11-yl)-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NC2CCCCC23OCCCO3)cc1 |
| InChI | InChI=1S/C17H24N2O5S/c1-13-6-8-14(9-7-13)25(21,22)19-16(20)18-15-5-2-3-10-17(15)23-11-4-12-24-17/h6-9,15H,2-5,10-12H2,1H3,(H2,18,19,20) |
| InChIKey | SBRBRIAKBFFVSB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |