C15H22N4O4S — CID 2370277
1-cyclohexyl-3-[(4-methylphenyl)sulfonylcarbamoylamino]urea (PubChem CID 2370277) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(4-methylphenyl)sulfonylcarbamoylamino]urea.
| Compound Name | 1-cyclohexyl-3-[(4-methylphenyl)sulfonylcarbamoylamino]urea |
|---|---|
| PubChem CID | 2370277 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-cyclohexyl-3-[(4-methylphenyl)sulfonylcarbamoylamino]urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NNC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H22N4O4S/c1-11-7-9-13(10-8-11)24(22,23)19-15(21)18-17-14(20)16-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H2,16,17,20)(H2,18,19,21) |
| InChIKey | MBWICGAGPMUOCE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|