C14H20N2O4S — CID 40596016
1-[(1R,2R)-2-hydroxycyclohexyl]-3-(4-methylphenyl)sulfonylurea (PubChem CID 40596016) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-[(1R,2R)-2-hydroxycyclohexyl]-3-(4-methylphenyl)sulfonylurea.
| Compound Name | 1-[(1R,2R)-2-hydroxycyclohexyl]-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 40596016 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[(1R,2R)-2-hydroxycyclohexyl]-3-(4-methylphenyl)sulfonylurea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N[C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C14H20N2O4S/c1-10-6-8-11(9-7-10)21(19,20)16-14(18)15-12-4-2-3-5-13(12)17/h6-9,12-13,17H,2-5H2,1H3,(H2,15,16,18)/t12-,13-/m1/s1 |
| InChIKey | MTGRWHDDDGKLLX-CHWSQXEVSA-N |
| XLogP | 1.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |