C11H13NO3S — CID 46179849
N-(4-methylphenyl)sulfonylcyclopropanecarboxamide (PubChem CID 46179849) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonylcyclopropanecarboxamide.
| Compound Name | N-(4-methylphenyl)sulfonylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 46179849 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-(4-methylphenyl)sulfonylcyclopropanecarboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C11H13NO3S/c1-8-2-6-10(7-3-8)16(14,15)12-11(13)9-4-5-9/h2-3,6-7,9H,4-5H2,1H3,(H,12,13) |
| InChIKey | WDOYWJXXSGMIOV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |