C9H14N4O4S — CID 160676948
(4-methylphenyl)sulfonylurea;urea (PubChem CID 160676948) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is (4-methylphenyl)sulfonylurea;urea.
| Compound Name | (4-methylphenyl)sulfonylurea;urea |
|---|---|
| PubChem CID | 160676948 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (4-methylphenyl)sulfonylurea;urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(N)=O)cc1.NC(N)=O |
| InChI | InChI=1S/C8H10N2O3S.CH4N2O/c1-6-2-4-7(5-3-6)14(12,13)10-8(9)11;2-1(3)4/h2-5H,1H3,(H3,9,10,11);(H4,2,3,4) |
| InChIKey | RNQQGKHMADXWJH-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 158.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |