C16H16N2O6S2 — CID 135051885
N-(benzenesulfonyl)-N'-(4-methylphenyl)sulfonylpropanediamide (PubChem CID 135051885) has the molecular formula C16H16N2O6S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N'-(4-methylphenyl)sulfonylpropanediamide.
| Compound Name | N-(benzenesulfonyl)-N'-(4-methylphenyl)sulfonylpropanediamide |
|---|---|
| PubChem CID | 135051885 |
| Molecular Formula | C16H16N2O6S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-(benzenesulfonyl)-N'-(4-methylphenyl)sulfonylpropanediamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)CC(=O)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O6S2/c1-12-7-9-14(10-8-12)26(23,24)18-16(20)11-15(19)17-25(21,22)13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | ZTBSQPKYAOVRDZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|