C15H23NO3S — CID 13094109
N-(4-methylphenyl)sulfonyloctanamide (PubChem CID 13094109) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyloctanamide.
| Compound Name | N-(4-methylphenyl)sulfonyloctanamide |
|---|---|
| PubChem CID | 13094109 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-(4-methylphenyl)sulfonyloctanamide |
| SMILES | CCCCCCCC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H23NO3S/c1-3-4-5-6-7-8-15(17)16-20(18,19)14-11-9-13(2)10-12-14/h9-12H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | RXHJVFQLJPGBFA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|