C12H18N2O3SZn+2 — CID 54606239
zinc 1-butyl-3-(4-methylphenyl)sulfonylurea (PubChem CID 54606239) has the molecular formula C12H18N2O3SZn+2 and a molecular weight of 335.74 g/mol. Its IUPAC name is zinc 1-butyl-3-(4-methylphenyl)sulfonylurea.
| Compound Name | zinc 1-butyl-3-(4-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 54606239 |
| Molecular Formula | C12H18N2O3SZn+2 |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | zinc 1-butyl-3-(4-methylphenyl)sulfonylurea |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(C)cc1.[Zn+2] |
| InChI | InChI=1S/C12H18N2O3S.Zn/c1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11;/h5-8H,3-4,9H2,1-2H3,(H2,13,14,15);/q;+2 |
| InChIKey | ORLOHSBQLIWGNM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|