C12H18N2O3S — CID 70503180
1-(benzenesulfonyl)-3-pentylurea (PubChem CID 70503180) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-pentylurea.
| Compound Name | 1-(benzenesulfonyl)-3-pentylurea |
|---|---|
| PubChem CID | 70503180 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(benzenesulfonyl)-3-pentylurea |
| SMILES | CCCCCNC(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-2-3-7-10-13-12(15)14-18(16,17)11-8-5-4-6-9-11/h4-6,8-9H,2-3,7,10H2,1H3,(H2,13,14,15) |
| InChIKey | CEDOZDHKXSPOPC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|